C26H35ClO — CID 143898482
(4S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4,6-dimethyloxane;ethene (PubChem CID 143898482) has the molecular formula C26H35ClO and a molecular weight of 399.02 g/mol. Its IUPAC name is (4S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4,6-dimethyloxane;ethene.
| Compound Name | (4S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4,6-dimethyloxane;ethene |
|---|---|
| PubChem CID | 143898482 |
| Molecular Formula | C26H35ClO |
| Molecular Weight | 399.02 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (4S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4,6-dimethyloxane;ethene |
| SMILES | C=C.C=C.CCc1ccc(Cc2cc(C3C[C@@H](C)C[C@@H](C)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO.2C2H4/c1-4-17-5-7-18(8-6-17)13-20-14-19(9-10-21(20)23)22-12-15(2)11-16(3)24-22;2*1-2/h5-10,14-16,22H,4,11-13H2,1-3H3;2*1-2H2/t15-,16+,22?;;/m0../s1 |
| InChIKey | ACFNXMJUAGLJAL-MQAQHWIVSA-N |
| XLogP | 7.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.02 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|