C23H25ClO2 — CID 123972160
2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-3-ethyl-6-methyloxan-4-ol (PubChem CID 123972160) has the molecular formula C23H25ClO2 and a molecular weight of 368.90 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-3-ethyl-6-methyloxan-4-ol.
| Compound Name | 2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-3-ethyl-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 123972160 |
| Molecular Formula | C23H25ClO2 |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-3-ethyl-6-methyloxan-4-ol |
| SMILES | C#Cc1ccc(Cc2cc(C3OC(C)CC(O)C3CC)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClO2/c1-4-16-6-8-17(9-7-16)13-19-14-18(10-11-21(19)24)23-20(5-2)22(25)12-15(3)26-23/h1,6-11,14-15,20,22-23,25H,5,12-13H2,2-3H3 |
| InChIKey | AGMFAUYDQGMFQD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|