C27H37ClO4 — CID 143726294
butan-1-ol;(2R,4R,6S)-2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane (PubChem CID 143726294) has the molecular formula C27H37ClO4 and a molecular weight of 461.04 g/mol. Its IUPAC name is butan-1-ol;(2R,4R,6S)-2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane.
| Compound Name | butan-1-ol;(2R,4R,6S)-2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane |
|---|---|
| PubChem CID | 143726294 |
| Molecular Formula | C27H37ClO4 |
| Molecular Weight | 461.04 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | butan-1-ol;(2R,4R,6S)-2-[4-chloro-3-[(4-ethynylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane |
| SMILES | C#Cc1ccc(Cc2cc([C@H]3C[C@@H](O)C[C@@H](CO)O3)ccc2Cl)cc1.CC.CCCCO |
| InChI | InChI=1S/C21H21ClO3.C4H10O.C2H6/c1-2-14-3-5-15(6-4-14)9-17-10-16(7-8-20(17)22)21-12-18(24)11-19(13-23)25-21;1-2-3-4-5;1-2/h1,3-8,10,18-19,21,23-24H,9,11-13H2;5H,2-4H2,1H3;1-2H3/t18-,19-,21+;;/m0../s1 |
| InChIKey | GFZVEAPMYPEJCJ-REJIRYJKSA-N |
| XLogP | 5.29 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.04 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|