C26H29ClO4 — CID 143726272
(2R,4R)-2-[4-chloro-3-[[4-[2-(1-hydroxycyclopentyl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143726272) has the molecular formula C26H29ClO4 and a molecular weight of 440.97 g/mol. Its IUPAC name is (2R,4R)-2-[4-chloro-3-[[4-[2-(1-hydroxycyclopentyl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | (2R,4R)-2-[4-chloro-3-[[4-[2-(1-hydroxycyclopentyl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143726272 |
| Molecular Formula | C26H29ClO4 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2R,4R)-2-[4-chloro-3-[[4-[2-(1-hydroxycyclopentyl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | OCC1C[C@H](O)C[C@H](c2ccc(Cl)c(Cc3ccc(C#CC4(O)CCCC4)cc3)c2)O1 |
| InChI | InChI=1S/C26H29ClO4/c27-24-8-7-20(25-16-22(29)15-23(17-28)31-25)14-21(24)13-19-5-3-18(4-6-19)9-12-26(30)10-1-2-11-26/h3-8,14,22-23,25,28-30H,1-2,10-11,13,15-17H2/t22-,23?,25+/m0/s1 |
| InChIKey | RJKFLUAUMYJSRT-OPEVTLNRSA-N |
| XLogP | 4.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|