C26H29ClO7 — CID 143726260
(2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(4-hydroxyoxan-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 143726260) has the molecular formula C26H29ClO7 and a molecular weight of 488.96 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(4-hydroxyoxan-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(4-hydroxyoxan-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143726260 |
| Molecular Formula | C26H29ClO7 |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(4-hydroxyoxan-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(C#CC4(O)CCOCC4)cc3)c2)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C26H29ClO7/c27-20-6-5-18(25-24(31)23(30)22(29)21(15-28)34-25)14-19(20)13-17-3-1-16(2-4-17)7-8-26(32)9-11-33-12-10-26/h1-6,14,21-25,28-32H,9-13,15H2/t21-,22-,23?,24-,25+/m1/s1 |
| InChIKey | AVORUPJUOIYVRC-ZJNKMKHDSA-N |
| XLogP | 1.34 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|