C23H25ClO8 — CID 71539866
(2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-benzodioxole-2,3'-oxolane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71539866) has the molecular formula C23H25ClO8 and a molecular weight of 464.90 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-benzodioxole-2,3'-oxolane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-benzodioxole-2,3'-oxolane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71539866 |
| Molecular Formula | C23H25ClO8 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-benzodioxole-2,3'-oxolane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](c2ccc(Cl)c(Cc3ccc4c(c3)OC3(CCOC3)O4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H25ClO8/c24-15-3-2-13(22-21(28)20(27)19(26)18(10-25)30-22)9-14(15)7-12-1-4-16-17(8-12)32-23(31-16)5-6-29-11-23/h1-4,8-9,18-22,25-28H,5-7,10-11H2/t18-,19-,20+,21-,22-,23?/m1/s1 |
| InChIKey | SPBXMSUFHAIKER-HRRCLKEASA-N |
| XLogP | 1.33 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |