C24H27ClO6 — CID 71539817
(2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-dihydroindene-2,3'-oxetane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71539817) has the molecular formula C24H27ClO6 and a molecular weight of 446.93 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-dihydroindene-2,3'-oxetane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-dihydroindene-2,3'-oxetane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71539817 |
| Molecular Formula | C24H27ClO6 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-(spiro[1,3-dihydroindene-2,3'-oxetane]-5-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](c2ccc(Cl)c(Cc3ccc4c(c3)CC3(COC3)C4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H27ClO6/c25-18-4-3-14(23-22(29)21(28)20(27)19(10-26)31-23)7-16(18)5-13-1-2-15-8-24(11-30-12-24)9-17(15)6-13/h1-4,6-7,19-23,26-29H,5,8-12H2/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | RHTJWBJCLPKQPP-XNBWIAOKSA-N |
| XLogP | 1.56 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |