C23H26ClNO7 — CID 52914182
1-[6-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone (PubChem CID 52914182) has the molecular formula C23H26ClNO7 and a molecular weight of 463.91 g/mol. Its IUPAC name is 1-[6-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone.
| Compound Name | 1-[6-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 52914182 |
| Molecular Formula | C23H26ClNO7 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-[6-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCOc2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc21 |
| InChI | InChI=1S/C23H26ClNO7/c1-12(27)25-6-7-31-18-5-2-13(9-17(18)25)8-15-10-14(3-4-16(15)24)23-22(30)21(29)20(28)19(11-26)32-23/h2-5,9-10,19-23,26,28-30H,6-8,11H2,1H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | XVOULZXLKDTKIY-ZQGJOIPISA-N |
| XLogP | 1.19 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |