C30H34ClNO6 — CID 67115821
(2S,5S,6R)-2-[3-[(4-benzyl-2,2-dimethyl-3H-1,4-benzoxazin-6-yl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 67115821) has the molecular formula C30H34ClNO6 and a molecular weight of 540.06 g/mol. Its IUPAC name is (2S,5S,6R)-2-[3-[(4-benzyl-2,2-dimethyl-3H-1,4-benzoxazin-6-yl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,5S,6R)-2-[3-[(4-benzyl-2,2-dimethyl-3H-1,4-benzoxazin-6-yl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67115821 |
| Molecular Formula | C30H34ClNO6 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2S,5S,6R)-2-[3-[(4-benzyl-2,2-dimethyl-3H-1,4-benzoxazin-6-yl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1(C)CN(Cc2ccccc2)c2cc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)C(O)C4O)ccc3Cl)ccc2O1 |
| InChI | InChI=1S/C30H34ClNO6/c1-30(2)17-32(15-18-6-4-3-5-7-18)23-13-19(8-11-24(23)38-30)12-21-14-20(9-10-22(21)31)29-28(36)27(35)26(34)25(16-33)37-29/h3-11,13-14,25-29,33-36H,12,15-17H2,1-2H3/t25-,26-,27?,28?,29+/m1/s1 |
| InChIKey | JKXGJIXLTNSXKZ-SPPGQTCJSA-N |
| XLogP | 3.62 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |