C21H24BrClO6 — CID 134256538
(2R,3R,4R,5S,6R)-2-[3-[(3-bromo-4-ethoxyphenyl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 134256538) has the molecular formula C21H24BrClO6 and a molecular weight of 487.77 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[3-[(3-bromo-4-ethoxyphenyl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[3-[(3-bromo-4-ethoxyphenyl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134256538 |
| Molecular Formula | C21H24BrClO6 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[3-[(3-bromo-4-ethoxyphenyl)methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1Br |
| InChI | InChI=1S/C21H24BrClO6/c1-2-28-16-6-3-11(8-14(16)22)7-13-9-12(4-5-15(13)23)21-20(27)19(26)18(25)17(10-24)29-21/h3-6,8-9,17-21,24-27H,2,7,10H2,1H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | PYWIJQRSYWJDBH-YMQHIKHWSA-N |
| XLogP | 2.61 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |