C27H27ClN2O6 — CID 143282381
(2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(6-ethoxypyridazin-3-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 143282381) has the molecular formula C27H27ClN2O6 and a molecular weight of 510.97 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(6-ethoxypyridazin-3-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(6-ethoxypyridazin-3-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143282381 |
| Molecular Formula | C27H27ClN2O6 |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(6-ethoxypyridazin-3-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(C#Cc2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)C(O)[C@H]4O)ccc3Cl)cc2)nn1 |
| InChI | InChI=1S/C27H27ClN2O6/c1-2-35-23-12-10-20(29-30-23)9-7-16-3-5-17(6-4-16)13-19-14-18(8-11-21(19)28)27-26(34)25(33)24(32)22(15-31)36-27/h3-6,8,10-12,14,22,24-27,31-34H,2,13,15H2,1H3/t22-,24-,25?,26-,27+/m1/s1 |
| InChIKey | AJPMWJXCGLBGEF-FMQRYIFSSA-N |
| XLogP | 2.03 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|