C25H25ClN2O5 — CID 71085540
(2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(1-methylimidazol-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71085540) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(1-methylimidazol-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(1-methylimidazol-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71085540 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (2S,3R,5S,6R)-2-[4-chloro-3-[[4-[2-(1-methylimidazol-4-yl)ethynyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cn1cnc(C#Cc2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)C(O)[C@H]4O)ccc3Cl)cc2)c1 |
| InChI | InChI=1S/C25H25ClN2O5/c1-28-12-19(27-14-28)8-6-15-2-4-16(5-3-15)10-18-11-17(7-9-20(18)26)25-24(32)23(31)22(30)21(13-29)33-25/h2-5,7,9,11-12,14,21-25,29-32H,10,13H2,1H3/t21-,22-,23?,24-,25+/m1/s1 |
| InChIKey | GVTPVTRJGXPTTO-ZJNKMKHDSA-N |
| XLogP | 1.58 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|