C23H25ClO6 — CID 143242989
(3R,5S,6R)-2-[4-chloro-3-[[4-(3-methoxyprop-1-ynyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 143242989) has the molecular formula C23H25ClO6 and a molecular weight of 432.90 g/mol. Its IUPAC name is (3R,5S,6R)-2-[4-chloro-3-[[4-(3-methoxyprop-1-ynyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,5S,6R)-2-[4-chloro-3-[[4-(3-methoxyprop-1-ynyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143242989 |
| Molecular Formula | C23H25ClO6 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (3R,5S,6R)-2-[4-chloro-3-[[4-(3-methoxyprop-1-ynyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COCC#Cc1ccc(Cc2cc(C3O[C@H](CO)[C@@H](O)C(O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClO6/c1-29-10-2-3-14-4-6-15(7-5-14)11-17-12-16(8-9-18(17)24)23-22(28)21(27)20(26)19(13-25)30-23/h4-9,12,19-23,25-28H,10-11,13H2,1H3/t19-,20-,21?,22-,23?/m1/s1 |
| InChIKey | NGSPZNVILGIELD-NQNZBYAZSA-N |
| XLogP | 1.44 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|