C22H27ClO4S — CID 168843565
(1S,2R,3S,6S)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methylsulfanylcyclohexane-1,2,3-triol (PubChem CID 168843565) has the molecular formula C22H27ClO4S and a molecular weight of 422.97 g/mol. Its IUPAC name is (1S,2R,3S,6S)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methylsulfanylcyclohexane-1,2,3-triol.
| Compound Name | (1S,2R,3S,6S)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methylsulfanylcyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 168843565 |
| Molecular Formula | C22H27ClO4S |
| Molecular Weight | 422.97 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (1S,2R,3S,6S)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methylsulfanylcyclohexane-1,2,3-triol |
| SMILES | CCOc1ccc(Cc2cc(C3C[C@H](SC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO4S/c1-3-27-16-7-4-13(5-8-16)10-15-11-14(6-9-18(15)23)17-12-19(28-2)21(25)22(26)20(17)24/h4-9,11,17,19-22,24-26H,3,10,12H2,1-2H3/t17?,19-,20-,21+,22+/m0/s1 |
| InChIKey | WJMZDOVTGRKYTE-UJSBRMLGSA-N |
| XLogP | 3.63 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |