C22H28O3 — CID 145407345
4-[[2-ethyl-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenol (PubChem CID 145407345) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 4-[[2-ethyl-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenol.
| Compound Name | 4-[[2-ethyl-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 145407345 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-[[2-ethyl-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenol |
| SMILES | CCc1ccc(C2CC(O)CC(CO)C2)cc1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H28O3/c1-2-17-5-6-18(20-10-16(14-23)11-22(25)13-20)12-19(17)9-15-3-7-21(24)8-4-15/h3-8,12,16,20,22-25H,2,9-11,13-14H2,1H3 |
| InChIKey | RDNZNPJGSBUINC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |