C22H28O4 — CID 143173165
3-(hydroxymethyl)-5-[2-[(4-methoxyphenyl)methyl]-5-methylphenoxy]cyclohexan-1-ol (PubChem CID 143173165) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-[2-[(4-methoxyphenyl)methyl]-5-methylphenoxy]cyclohexan-1-ol.
| Compound Name | 3-(hydroxymethyl)-5-[2-[(4-methoxyphenyl)methyl]-5-methylphenoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143173165 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-(hydroxymethyl)-5-[2-[(4-methoxyphenyl)methyl]-5-methylphenoxy]cyclohexan-1-ol |
| SMILES | COc1ccc(Cc2ccc(C)cc2OC2CC(O)CC(CO)C2)cc1 |
| InChI | InChI=1S/C22H28O4/c1-15-3-6-18(10-16-4-7-20(25-2)8-5-16)22(9-15)26-21-12-17(14-23)11-19(24)13-21/h3-9,17,19,21,23-24H,10-14H2,1-2H3 |
| InChIKey | GOBWNPUKHNNRIA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |