C21H27NO7 — CID 68986257
(2R,3S,4R,5R,6S)-6-[5-amino-2-[(4-methoxyphenyl)methyl]phenoxy]-2-(hydroxymethyl)-3-methyloxane-3,4,5-triol (PubChem CID 68986257) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-6-[5-amino-2-[(4-methoxyphenyl)methyl]phenoxy]-2-(hydroxymethyl)-3-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-6-[5-amino-2-[(4-methoxyphenyl)methyl]phenoxy]-2-(hydroxymethyl)-3-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 68986257 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2R,3S,4R,5R,6S)-6-[5-amino-2-[(4-methoxyphenyl)methyl]phenoxy]-2-(hydroxymethyl)-3-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2ccc(N)cc2O[C@@H]2O[C@H](CO)[C@@](C)(O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H27NO7/c1-21(26)17(11-23)29-20(18(24)19(21)25)28-16-10-14(22)6-5-13(16)9-12-3-7-15(27-2)8-4-12/h3-8,10,17-20,23-26H,9,11,22H2,1-2H3/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | IGRIXOFWQXIBHH-PFAUGDHASA-N |
| XLogP | 0.44 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|