C41H36O10 — CID 69477950
[(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-3-yl]-phenylmethanone (PubChem CID 69477950) has the molecular formula C41H36O10 and a molecular weight of 688.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-3-yl]-phenylmethanone.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 69477950 |
| Molecular Formula | C41H36O10 |
| Molecular Weight | 688.73 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-3-yl]-phenylmethanone |
| SMILES | COc1ccc(Cc2ccccc2O[C@@H]2O[C@H](CO)[C@](O)(C(=O)c3ccccc3)[C@@](O)(C(=O)c3ccccc3)[C@]2(O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H36O10/c1-49-32-23-21-27(22-24-32)25-31-19-11-12-20-33(31)50-38-40(47,36(44)29-15-7-3-8-16-29)41(48,37(45)30-17-9-4-10-18-30)39(46,34(26-42)51-38)35(43)28-13-5-2-6-14-28/h2-24,34,38,42,46-48H,25-26H2,1H3/t34-,38-,39+,40+,41+/m1/s1 |
| InChIKey | PFVWWJHHJCFPSW-VRGRYHIJSA-N |
| XLogP | 4.22 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.73 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |