C24H30O10 — CID 91400947
2-methoxyethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]oxane-3-carboxylate (PubChem CID 91400947) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-methoxyethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]oxane-3-carboxylate.
| Compound Name | 2-methoxyethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]oxane-3-carboxylate |
|---|---|
| PubChem CID | 91400947 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-methoxyethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]oxane-3-carboxylate |
| SMILES | COCCOC(=O)[C@]1(O)[C@@H](Oc2ccccc2Cc2ccc(OC)cc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H30O10/c1-30-11-12-32-22(28)24(29)21(27)20(26)19(14-25)34-23(24)33-18-6-4-3-5-16(18)13-15-7-9-17(31-2)10-8-15/h3-10,19-21,23,25-27,29H,11-14H2,1-2H3/t19-,20-,21+,23+,24+/m1/s1 |
| InChIKey | HZTVRIQSFODEFM-LBQHQWNISA-N |
| XLogP | 0.02 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|