C20H21F3O7 — CID 10181087
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[[4-(trifluoromethoxy)phenyl]methyl]phenoxy]oxane-3,4,5-triol (PubChem CID 10181087) has the molecular formula C20H21F3O7 and a molecular weight of 430.38 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[[4-(trifluoromethoxy)phenyl]methyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[[4-(trifluoromethoxy)phenyl]methyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10181087 |
| Molecular Formula | C20H21F3O7 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[[4-(trifluoromethoxy)phenyl]methyl]phenoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2ccccc2Cc2ccc(OC(F)(F)F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H21F3O7/c21-20(22,23)30-13-7-5-11(6-8-13)9-12-3-1-2-4-14(12)28-19-18(27)17(26)16(25)15(10-24)29-19/h1-8,15-19,24-27H,9-10H2/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | VKZGREZNZWCQRM-UJWQCDCRSA-N |
| XLogP | 1.35 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |