C21H26O6 — CID 58191924
(2R,3S,4S,5R,6S)-2-(methoxymethyl)-6-[2-[(4-methylphenyl)methyl]phenoxy]oxane-3,4,5-triol (PubChem CID 58191924) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(methoxymethyl)-6-[2-[(4-methylphenyl)methyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(methoxymethyl)-6-[2-[(4-methylphenyl)methyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58191924 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(methoxymethyl)-6-[2-[(4-methylphenyl)methyl]phenoxy]oxane-3,4,5-triol |
| SMILES | COC[C@H]1O[C@@H](Oc2ccccc2Cc2ccc(C)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H26O6/c1-13-7-9-14(10-8-13)11-15-5-3-4-6-16(15)26-21-20(24)19(23)18(22)17(27-21)12-25-2/h3-10,17-24H,11-12H2,1-2H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | OWYZCCSNTOXFFV-YMQHIKHWSA-N |
| XLogP | 1.42 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |