C20H24O6 — CID 70981169
2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane-3,4,5-triol (PubChem CID 70981169) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane-3,4,5-triol.
| Compound Name | 2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 70981169 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2ccccc2OC2OC(C)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C20H24O6/c1-12-17(21)18(22)19(23)20(25-12)26-16-6-4-3-5-14(16)11-13-7-9-15(24-2)10-8-13/h3-10,12,17-23H,11H2,1-2H3 |
| InChIKey | OKHKIYYKNSXISO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |