C22H24O9 — CID 143898481
methyl [(E)-[(3S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-ylidene]methyl] carbonate (PubChem CID 143898481) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is methyl [(E)-[(3S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-ylidene]methyl] carbonate.
| Compound Name | methyl [(E)-[(3S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-ylidene]methyl] carbonate |
|---|---|
| PubChem CID | 143898481 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl [(E)-[(3S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-ylidene]methyl] carbonate |
| SMILES | COC(=O)O/C=C1/OC(Oc2ccccc2Cc2ccc(OC)cc2)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C22H24O9/c1-27-15-9-7-13(8-10-15)11-14-5-3-4-6-16(14)30-21-20(25)19(24)18(23)17(31-21)12-29-22(26)28-2/h3-10,12,18-21,23-25H,11H2,1-2H3/b17-12+/t18-,19?,20-,21?/m1/s1 |
| InChIKey | JGZPVGNMCIVLED-CQRLJNJESA-N |
| XLogP | 1.73 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|