C20H24O3 — CID 66634376
(2S,6R)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane (PubChem CID 66634376) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,6R)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane.
| Compound Name | (2S,6R)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane |
|---|---|
| PubChem CID | 66634376 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2S,6R)-2-[2-[(4-methoxyphenyl)methyl]phenoxy]-6-methyloxane |
| SMILES | COc1ccc(Cc2ccccc2O[C@H]2CCC[C@@H](C)O2)cc1 |
| InChI | InChI=1S/C20H24O3/c1-15-6-5-9-20(22-15)23-19-8-4-3-7-17(19)14-16-10-12-18(21-2)13-11-16/h3-4,7-8,10-13,15,20H,5-6,9,14H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | IHFJOFIRFCYUQR-QRWLVFNGSA-N |
| XLogP | 4.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |