C24H29NO6 — CID 146214219
ethyl 3-[6-[2-[(4-methoxyphenyl)methyl]phenoxy]-4-nitrosooxan-2-yl]propanoate (PubChem CID 146214219) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl 3-[6-[2-[(4-methoxyphenyl)methyl]phenoxy]-4-nitrosooxan-2-yl]propanoate.
| Compound Name | ethyl 3-[6-[2-[(4-methoxyphenyl)methyl]phenoxy]-4-nitrosooxan-2-yl]propanoate |
|---|---|
| PubChem CID | 146214219 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | ethyl 3-[6-[2-[(4-methoxyphenyl)methyl]phenoxy]-4-nitrosooxan-2-yl]propanoate |
| SMILES | CCOC(=O)CCC1CC(N=O)CC(Oc2ccccc2Cc2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C24H29NO6/c1-3-29-23(26)13-12-21-15-19(25-27)16-24(30-21)31-22-7-5-4-6-18(22)14-17-8-10-20(28-2)11-9-17/h4-11,19,21,24H,3,12-16H2,1-2H3 |
| InChIKey | KGZBKIPOKMEQOD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |