C22H26O7 — CID 143843045
[(3S)-6-(2-benzylphenoxy)-3,4-dihydroxyoxan-2-yl]methyl ethyl carbonate (PubChem CID 143843045) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(3S)-6-(2-benzylphenoxy)-3,4-dihydroxyoxan-2-yl]methyl ethyl carbonate.
| Compound Name | [(3S)-6-(2-benzylphenoxy)-3,4-dihydroxyoxan-2-yl]methyl ethyl carbonate |
|---|---|
| PubChem CID | 143843045 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(3S)-6-(2-benzylphenoxy)-3,4-dihydroxyoxan-2-yl]methyl ethyl carbonate |
| SMILES | CCOC(=O)OCC1OC(Oc2ccccc2Cc2ccccc2)CC(O)[C@@H]1O |
| InChI | InChI=1S/C22H26O7/c1-2-26-22(25)27-14-19-21(24)17(23)13-20(29-19)28-18-11-7-6-10-16(18)12-15-8-4-3-5-9-15/h3-11,17,19-21,23-24H,2,12-14H2,1H3/t17?,19?,20?,21-/m0/s1 |
| InChIKey | KOBGWGAEJJVPEL-SLQSYFLNSA-N |
| XLogP | 2.67 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |