C24H30O6 — CID 142133451
ethyl [6-[2-[(4-ethylphenyl)methyl]phenoxy]-4-hydroxyoxan-2-yl]methyl carbonate (PubChem CID 142133451) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl [6-[2-[(4-ethylphenyl)methyl]phenoxy]-4-hydroxyoxan-2-yl]methyl carbonate.
| Compound Name | ethyl [6-[2-[(4-ethylphenyl)methyl]phenoxy]-4-hydroxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 142133451 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | ethyl [6-[2-[(4-ethylphenyl)methyl]phenoxy]-4-hydroxyoxan-2-yl]methyl carbonate |
| SMILES | CCOC(=O)OCC1CC(O)CC(Oc2ccccc2Cc2ccc(CC)cc2)O1 |
| InChI | InChI=1S/C24H30O6/c1-3-17-9-11-18(12-10-17)13-19-7-5-6-8-22(19)30-23-15-20(25)14-21(29-23)16-28-24(26)27-4-2/h5-12,20-21,23,25H,3-4,13-16H2,1-2H3 |
| InChIKey | RQBUCRZWYKIXGE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |