C15H20O6 — CID 123138168
ethyl 2-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate (PubChem CID 123138168) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is ethyl 2-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate.
| Compound Name | ethyl 2-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 123138168 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl 2-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
| SMILES | CCOC(=O)c1ccccc1OC1CC(O)CC(CO)O1 |
| InChI | InChI=1S/C15H20O6/c1-2-19-15(18)12-5-3-4-6-13(12)21-14-8-10(17)7-11(9-16)20-14/h3-6,10-11,14,16-17H,2,7-9H2,1H3 |
| InChIKey | CCWWUDJIPAJXLG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |