About ethyl 2-acetyloxybenzoate;hydrochloride
ethyl 2-acetyloxybenzoate;hydrochloride (PubChem CID 168984732) has the molecular formula C11H13ClO4
and a molecular weight of 244.67 g/mol. Its IUPAC name is ethyl 2-acetyloxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-acetyloxybenzoate;hydrochloride |
| PubChem CID | 168984732 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | ethyl 2-acetyloxybenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccccc1OC(C)=O.Cl |
| InChI | InChI=1S/C11H12O4.ClH/c1-3-14-11(13)9-6-4-5-7-10(9)15-8(2)12;/h4-7H,3H2,1-2H3;1H |
| InChIKey | KXVZQDKZUMERAQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetyloxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetyloxybenzoate;hydrochloride?
The IUPAC name of ethyl 2-acetyloxybenzoate;hydrochloride (CID 168984732) is ethyl 2-acetyloxybenzoate;hydrochloride.
What is the SMILES notation for ethyl 2-acetyloxybenzoate;hydrochloride?
The canonical SMILES for ethyl 2-acetyloxybenzoate;hydrochloride is CCOC(=O)c1ccccc1OC(C)=O.Cl.
What is the InChIKey of ethyl 2-acetyloxybenzoate;hydrochloride?
The InChIKey is KXVZQDKZUMERAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4.ClH/c1-3-14-11(13)9-6-4-5-7-10(9)15-8(2)12;/h4-7H,3H2,1-2H3;1H.
What are the key properties of ethyl 2-acetyloxybenzoate;hydrochloride?
ethyl 2-acetyloxybenzoate;hydrochloride has a molecular weight of 244.67 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetyloxybenzoate;hydrochloride is sourced from PubChem (CID 168984732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).