About [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate
[4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate (PubChem CID 89252836) has the molecular formula C25H26O9
and a molecular weight of 470.47 g/mol. Its IUPAC name is [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate |
| PubChem CID | 89252836 |
| Molecular Formula | C25H26O9 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate |
| SMILES | CCOC(=O)Oc1ccccc1C(=O)OC1CCC(OC(=O)c2ccccc2OC(C)=O)CC1 |
| InChI | InChI=1S/C25H26O9/c1-3-30-25(29)34-22-11-7-5-9-20(22)24(28)33-18-14-12-17(13-15-18)32-23(27)19-8-4-6-10-21(19)31-16(2)26/h4-11,17-18H,3,12-15H2,1-2H3 |
| InChIKey | LZDVUZJOEQVXRC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate?
The IUPAC name of [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate (CID 89252836) is [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate.
What is the SMILES notation for [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate?
The canonical SMILES for [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate is CCOC(=O)Oc1ccccc1C(=O)OC1CCC(OC(=O)c2ccccc2OC(C)=O)CC1.
What is the InChIKey of [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate?
The InChIKey is LZDVUZJOEQVXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O9/c1-3-30-25(29)34-22-11-7-5-9-20(22)24(28)33-18-14-12-17(13-15-18)32-23(27)19-8-4-6-10-21(19)31-16(2)26/h4-11,17-18H,3,12-15H2,1-2H3.
What are the key properties of [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate?
[4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate has a molecular weight of 470.47 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-ethoxycarbonyloxybenzoyl)oxycyclohexyl] 2-acetyloxybenzoate is sourced from PubChem (CID 89252836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).