About ethyl 2-acetyloxybenzoate;pyridine
ethyl 2-acetyloxybenzoate;pyridine (PubChem CID 174842838) has the molecular formula C16H17NO4
and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 2-acetyloxybenzoate;pyridine.
Molecular Properties
| Compound Name | ethyl 2-acetyloxybenzoate;pyridine |
| PubChem CID | 174842838 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 2-acetyloxybenzoate;pyridine |
| SMILES | CCOC(=O)c1ccccc1OC(C)=O.c1ccncc1 |
| InChI | InChI=1S/C11H12O4.C5H5N/c1-3-14-11(13)9-6-4-5-7-10(9)15-8(2)12;1-2-4-6-5-3-1/h4-7H,3H2,1-2H3;1-5H |
| InChIKey | LOXFHMHBFUWYSX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetyloxybenzoate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetyloxybenzoate;pyridine?
The IUPAC name of ethyl 2-acetyloxybenzoate;pyridine (CID 174842838) is ethyl 2-acetyloxybenzoate;pyridine.
What is the SMILES notation for ethyl 2-acetyloxybenzoate;pyridine?
The canonical SMILES for ethyl 2-acetyloxybenzoate;pyridine is CCOC(=O)c1ccccc1OC(C)=O.c1ccncc1.
What is the InChIKey of ethyl 2-acetyloxybenzoate;pyridine?
The InChIKey is LOXFHMHBFUWYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4.C5H5N/c1-3-14-11(13)9-6-4-5-7-10(9)15-8(2)12;1-2-4-6-5-3-1/h4-7H,3H2,1-2H3;1-5H.
What are the key properties of ethyl 2-acetyloxybenzoate;pyridine?
ethyl 2-acetyloxybenzoate;pyridine has a molecular weight of 287.31 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetyloxybenzoate;pyridine is sourced from PubChem (CID 174842838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).