About chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate
chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate (PubChem CID 144553181) has the molecular formula C12H11ClO7
and a molecular weight of 302.67 g/mol. Its IUPAC name is chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate.
Molecular Properties
| Compound Name | chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate |
| PubChem CID | 144553181 |
| Molecular Formula | C12H11ClO7 |
| Molecular Weight | 302.67 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate |
| SMILES | CCOC(=O)Oc1ccccc1C(=O)OC(=O)OCCl |
| InChI | InChI=1S/C12H11ClO7/c1-2-17-11(15)19-9-6-4-3-5-8(9)10(14)20-12(16)18-7-13/h3-6H,2,7H2,1H3 |
| InChIKey | SHUYJWJYAISVPS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate?
The IUPAC name of chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate (CID 144553181) is chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate.
What is the SMILES notation for chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate?
The canonical SMILES for chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate is CCOC(=O)Oc1ccccc1C(=O)OC(=O)OCCl.
What is the InChIKey of chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate?
The InChIKey is SHUYJWJYAISVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO7/c1-2-17-11(15)19-9-6-4-3-5-8(9)10(14)20-12(16)18-7-13/h3-6H,2,7H2,1H3.
What are the key properties of chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate?
chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate has a molecular weight of 302.67 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethoxycarbonyl 2-ethoxycarbonyloxybenzoate is sourced from PubChem (CID 144553181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).