C16H16O5 — CID 142219479
ethyl 2-[(3Z)-hexa-1,3,5-trien-2-yl]oxycarbonyloxybenzoate (PubChem CID 142219479) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is ethyl 2-[(3Z)-hexa-1,3,5-trien-2-yl]oxycarbonyloxybenzoate.
| Compound Name | ethyl 2-[(3Z)-hexa-1,3,5-trien-2-yl]oxycarbonyloxybenzoate |
|---|---|
| PubChem CID | 142219479 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | ethyl 2-[(3Z)-hexa-1,3,5-trien-2-yl]oxycarbonyloxybenzoate |
| SMILES | C=C/C=C\C(=C)OC(=O)Oc1ccccc1C(=O)OCC |
| InChI | InChI=1S/C16H16O5/c1-4-6-9-12(3)20-16(18)21-14-11-8-7-10-13(14)15(17)19-5-2/h4,6-11H,1,3,5H2,2H3/b9-6- |
| InChIKey | FYROYAMDCOGPHG-TWGQIWQCSA-N |
| XLogP | 3.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|