About [2-(cyanomethyl)phenyl] ethyl carbonate
[2-(cyanomethyl)phenyl] ethyl carbonate (PubChem CID 165430803) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is [2-(cyanomethyl)phenyl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-(cyanomethyl)phenyl] ethyl carbonate |
| PubChem CID | 165430803 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | [2-(cyanomethyl)phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccccc1CC#N |
| InChI | InChI=1S/C11H11NO3/c1-2-14-11(13)15-10-6-4-3-5-9(10)7-8-12/h3-6H,2,7H2,1H3 |
| InChIKey | QNZFAUNRIYEISK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyanomethyl)phenyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyanomethyl)phenyl] ethyl carbonate?
The IUPAC name of [2-(cyanomethyl)phenyl] ethyl carbonate (CID 165430803) is [2-(cyanomethyl)phenyl] ethyl carbonate.
What is the SMILES notation for [2-(cyanomethyl)phenyl] ethyl carbonate?
The canonical SMILES for [2-(cyanomethyl)phenyl] ethyl carbonate is CCOC(=O)Oc1ccccc1CC#N.
What is the InChIKey of [2-(cyanomethyl)phenyl] ethyl carbonate?
The InChIKey is QNZFAUNRIYEISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-2-14-11(13)15-10-6-4-3-5-9(10)7-8-12/h3-6H,2,7H2,1H3.
What are the key properties of [2-(cyanomethyl)phenyl] ethyl carbonate?
[2-(cyanomethyl)phenyl] ethyl carbonate has a molecular weight of 205.21 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyanomethyl)phenyl] ethyl carbonate is sourced from PubChem (CID 165430803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).