About azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile
azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile (PubChem CID 87598174) has the molecular formula C9H12Cl2N2OPt
and a molecular weight of 430.19 g/mol. Its IUPAC name is azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile.
Molecular Properties
| Compound Name | azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile |
| PubChem CID | 87598174 |
| Molecular Formula | C9H12Cl2N2OPt |
| Molecular Weight | 430.19 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile |
| SMILES | COc1ccccc1CC#N.Cl[Pt]Cl.N |
| InChI | InChI=1S/C9H9NO.2ClH.H3N.Pt/c1-11-9-5-3-2-4-8(9)6-7-10;;;;/h2-5H,6H2,1H3;2*1H;1H3;/q;;;;+2/p-2 |
| InChIKey | CMBVUMMTRQAQDC-UHFFFAOYSA-L |
| XLogP | 3.30 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile?
The IUPAC name of azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile (CID 87598174) is azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile.
What is the SMILES notation for azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile?
The canonical SMILES for azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile is COc1ccccc1CC#N.Cl[Pt]Cl.N.
What is the InChIKey of azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile?
The InChIKey is CMBVUMMTRQAQDC-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H9NO.2ClH.H3N.Pt/c1-11-9-5-3-2-4-8(9)6-7-10;;;;/h2-5H,6H2,1H3;2*1H;1H3;/q;;;;+2/p-2.
What are the key properties of azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile?
azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile has a molecular weight of 430.19 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;dichloroplatinum;2-(2-methoxyphenyl)acetonitrile is sourced from PubChem (CID 87598174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).