About dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile
dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile (PubChem CID 159199429) has the molecular formula C9H7Cl2F2NOPt
and a molecular weight of 449.14 g/mol. Its IUPAC name is dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile.
Molecular Properties
| Compound Name | dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile |
| PubChem CID | 159199429 |
| Molecular Formula | C9H7Cl2F2NOPt |
| Molecular Weight | 449.14 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile |
| SMILES | Cl[Pt]Cl.N#CCc1ccccc1OC(F)F |
| InChI | InChI=1S/C9H7F2NO.2ClH.Pt/c10-9(11)13-8-4-2-1-3-7(8)5-6-12;;;/h1-4,9H,5H2;2*1H;/q;;;+2/p-2 |
| InChIKey | KPCBYOZVMISHQT-UHFFFAOYSA-L |
| XLogP | 3.73 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile?
The IUPAC name of dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile (CID 159199429) is dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile.
What is the SMILES notation for dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile?
The canonical SMILES for dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile is Cl[Pt]Cl.N#CCc1ccccc1OC(F)F.
What is the InChIKey of dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile?
The InChIKey is KPCBYOZVMISHQT-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7F2NO.2ClH.Pt/c10-9(11)13-8-4-2-1-3-7(8)5-6-12;;;/h1-4,9H,5H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile?
dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile has a molecular weight of 449.14 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;2-[2-(difluoromethoxy)phenyl]acetonitrile is sourced from PubChem (CID 159199429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).