C9H5Cl2F2NO — CID 118998262
2-[2,6-dichloro-3-(difluoromethoxy)phenyl]acetonitrile (PubChem CID 118998262) has the molecular formula C9H5Cl2F2NO and a molecular weight of 252.05 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-(difluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-[2,6-dichloro-3-(difluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 118998262 |
| Molecular Formula | C9H5Cl2F2NO |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | 2-[2,6-dichloro-3-(difluoromethoxy)phenyl]acetonitrile |
| SMILES | N#CCc1c(Cl)ccc(OC(F)F)c1Cl |
| InChI | InChI=1S/C9H5Cl2F2NO/c10-6-1-2-7(15-9(12)13)8(11)5(6)3-4-14/h1-2,9H,3H2 |
| InChIKey | AXTYRKZYQNRQOG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |