C8H5Cl3F2O — CID 118849305
2,3-dichloro-1-(chloromethyl)-4-(difluoromethoxy)benzene (PubChem CID 118849305) has the molecular formula C8H5Cl3F2O and a molecular weight of 261.48 g/mol. Its IUPAC name is 2,3-dichloro-1-(chloromethyl)-4-(difluoromethoxy)benzene.
| Compound Name | 2,3-dichloro-1-(chloromethyl)-4-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 118849305 |
| Molecular Formula | C8H5Cl3F2O |
| Molecular Weight | 261.48 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | 2,3-dichloro-1-(chloromethyl)-4-(difluoromethoxy)benzene |
| SMILES | FC(F)Oc1ccc(CCl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl3F2O/c9-3-4-1-2-5(14-8(12)13)7(11)6(4)10/h1-2,8H,3H2 |
| InChIKey | IYOHVSUDQOWBOA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|