C9H4Cl2F3N — CID 171009970
2-[3,6-dichloro-2-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 171009970) has the molecular formula C9H4Cl2F3N and a molecular weight of 254.04 g/mol. Its IUPAC name is 2-[3,6-dichloro-2-(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2-[3,6-dichloro-2-(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 171009970 |
| Molecular Formula | C9H4Cl2F3N |
| Molecular Weight | 254.04 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 2-[3,6-dichloro-2-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#CCc1c(Cl)ccc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C9H4Cl2F3N/c10-6-1-2-7(11)8(9(12,13)14)5(6)3-4-15/h1-2H,3H2 |
| InChIKey | AJLNSMRMXOSUIB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.04 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |