C8H4ClF2N — CID 2773576
2-(3-chloro-2,6-difluorophenyl)acetonitrile (PubChem CID 2773576) has the molecular formula C8H4ClF2N and a molecular weight of 187.58 g/mol. Its IUPAC name is 2-(3-chloro-2,6-difluorophenyl)acetonitrile.
| Compound Name | 2-(3-chloro-2,6-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 2773576 |
| Molecular Formula | C8H4ClF2N |
| Molecular Weight | 187.58 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 2-(3-chloro-2,6-difluorophenyl)acetonitrile |
| SMILES | N#CCc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C8H4ClF2N/c9-6-1-2-7(10)5(3-4-12)8(6)11/h1-2H,3H2 |
| InChIKey | NGGMFXRCXFGDMP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|