About 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile
2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile (PubChem CID 119002717) has the molecular formula C9H5F4N
and a molecular weight of 203.14 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile.
Analyze 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile?
The IUPAC name of 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile (CID 119002717) is 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile.
What is the SMILES notation for 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile?
The canonical SMILES for 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile is N#CCc1c(F)ccc(C(F)F)c1F.
What is the InChIKey of 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile?
The InChIKey is DTEQNYHSNLJPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F4N/c10-7-2-1-6(9(12)13)8(11)5(7)3-4-14/h1-2,9H,3H2.
What are the key properties of 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile?
2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile has a molecular weight of 203.14 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(difluoromethyl)-2,6-difluorophenyl]acetonitrile is sourced from PubChem (CID 119002717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).