About 2-(cyanomethyl)-3,4-difluorobenzonitrile
2-(cyanomethyl)-3,4-difluorobenzonitrile (PubChem CID 130896726) has the molecular formula C9H4F2N2
and a molecular weight of 178.14 g/mol. Its IUPAC name is 2-(cyanomethyl)-3,4-difluorobenzonitrile.
Molecular Properties
| Compound Name | 2-(cyanomethyl)-3,4-difluorobenzonitrile |
| PubChem CID | 130896726 |
| Molecular Formula | C9H4F2N2 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 2-(cyanomethyl)-3,4-difluorobenzonitrile |
| SMILES | N#CCc1c(C#N)ccc(F)c1F |
| InChI | InChI=1S/C9H4F2N2/c10-8-2-1-6(5-13)7(3-4-12)9(8)11/h1-2H,3H2 |
| InChIKey | GVUPULJQBIJKLY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyanomethyl)-3,4-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyanomethyl)-3,4-difluorobenzonitrile?
The IUPAC name of 2-(cyanomethyl)-3,4-difluorobenzonitrile (CID 130896726) is 2-(cyanomethyl)-3,4-difluorobenzonitrile.
What is the SMILES notation for 2-(cyanomethyl)-3,4-difluorobenzonitrile?
The canonical SMILES for 2-(cyanomethyl)-3,4-difluorobenzonitrile is N#CCc1c(C#N)ccc(F)c1F.
What is the InChIKey of 2-(cyanomethyl)-3,4-difluorobenzonitrile?
The InChIKey is GVUPULJQBIJKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F2N2/c10-8-2-1-6(5-13)7(3-4-12)9(8)11/h1-2H,3H2.
What are the key properties of 2-(cyanomethyl)-3,4-difluorobenzonitrile?
2-(cyanomethyl)-3,4-difluorobenzonitrile has a molecular weight of 178.14 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyanomethyl)-3,4-difluorobenzonitrile is sourced from PubChem (CID 130896726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).