C10H9F2NO — CID 117286623
2-[2,6-difluoro-3-(methoxymethyl)phenyl]acetonitrile (PubChem CID 117286623) has the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. Its IUPAC name is 2-[2,6-difluoro-3-(methoxymethyl)phenyl]acetonitrile.
| Compound Name | 2-[2,6-difluoro-3-(methoxymethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 117286623 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-[2,6-difluoro-3-(methoxymethyl)phenyl]acetonitrile |
| SMILES | COCc1ccc(F)c(CC#N)c1F |
| InChI | InChI=1S/C10H9F2NO/c1-14-6-7-2-3-9(11)8(4-5-13)10(7)12/h2-3H,4,6H2,1H3 |
| InChIKey | PFFDNBYMHYSTAY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |