C8H4ClF2N — CID 119020113
2-(2-chloro-4,6-difluorophenyl)acetonitrile (PubChem CID 119020113) has the molecular formula C8H4ClF2N and a molecular weight of 187.58 g/mol. Its IUPAC name is 2-(2-chloro-4,6-difluorophenyl)acetonitrile.
| Compound Name | 2-(2-chloro-4,6-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 119020113 |
| Molecular Formula | C8H4ClF2N |
| Molecular Weight | 187.58 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 2-(2-chloro-4,6-difluorophenyl)acetonitrile |
| SMILES | N#CCc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C8H4ClF2N/c9-7-3-5(10)4-8(11)6(7)1-2-12/h3-4H,1H2 |
| InChIKey | FZJUCALREDMFNM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |