C9H7F2NO — CID 84768896
2-(2,4-difluoro-6-methoxyphenyl)acetonitrile (PubChem CID 84768896) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 2-(2,4-difluoro-6-methoxyphenyl)acetonitrile.
| Compound Name | 2-(2,4-difluoro-6-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 84768896 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-(2,4-difluoro-6-methoxyphenyl)acetonitrile |
| SMILES | COc1cc(F)cc(F)c1CC#N |
| InChI | InChI=1S/C9H7F2NO/c1-13-9-5-6(10)4-8(11)7(9)2-3-12/h4-5H,2H2,1H3 |
| InChIKey | AHWOVEULPLOXFM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |