C10H10INO2 — CID 119002608
2-(4-iodo-2,6-dimethoxyphenyl)acetonitrile (PubChem CID 119002608) has the molecular formula C10H10INO2 and a molecular weight of 303.10 g/mol. Its IUPAC name is 2-(4-iodo-2,6-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(4-iodo-2,6-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 119002608 |
| Molecular Formula | C10H10INO2 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 2-(4-iodo-2,6-dimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(I)cc(OC)c1CC#N |
| InChI | InChI=1S/C10H10INO2/c1-13-9-5-7(11)6-10(14-2)8(9)3-4-12/h5-6H,3H2,1-2H3 |
| InChIKey | RDHUISUFPFCODK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|