C11H12BrNO3 — CID 84813475
2-(6-bromo-2,3,4-trimethoxyphenyl)acetonitrile (PubChem CID 84813475) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 2-(6-bromo-2,3,4-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-(6-bromo-2,3,4-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 84813475 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-(6-bromo-2,3,4-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(Br)c(CC#N)c(OC)c1OC |
| InChI | InChI=1S/C11H12BrNO3/c1-14-9-6-8(12)7(4-5-13)10(15-2)11(9)16-3/h6H,4H2,1-3H3 |
| InChIKey | WSSNGUINCGDZQH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |