C11H12BrNO — CID 84804582
2-(4-bromo-2-methoxy-3,6-dimethylphenyl)acetonitrile (PubChem CID 84804582) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxy-3,6-dimethylphenyl)acetonitrile.
| Compound Name | 2-(4-bromo-2-methoxy-3,6-dimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 84804582 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-(4-bromo-2-methoxy-3,6-dimethylphenyl)acetonitrile |
| SMILES | COc1c(C)c(Br)cc(C)c1CC#N |
| InChI | InChI=1S/C11H12BrNO/c1-7-6-10(12)8(2)11(14-3)9(7)4-5-13/h6H,4H2,1-3H3 |
| InChIKey | XOCHXSBGSCLKIT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |