C13H17NO3 — CID 125466854
2-(2,4,5-trimethoxy-3,6-dimethylphenyl)acetonitrile (PubChem CID 125466854) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(2,4,5-trimethoxy-3,6-dimethylphenyl)acetonitrile.
| Compound Name | 2-(2,4,5-trimethoxy-3,6-dimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 125466854 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(2,4,5-trimethoxy-3,6-dimethylphenyl)acetonitrile |
| SMILES | COc1c(C)c(OC)c(OC)c(C)c1CC#N |
| InChI | InChI=1S/C13H17NO3/c1-8-10(6-7-14)11(15-3)9(2)13(17-5)12(8)16-4/h6H2,1-5H3 |
| InChIKey | LVDMZFJFZKQABK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |