C15H15N3O3 — CID 86065154
2-[3,5-bis(cyanomethyl)-2,4,6-trimethoxyphenyl]acetonitrile (PubChem CID 86065154) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[3,5-bis(cyanomethyl)-2,4,6-trimethoxyphenyl]acetonitrile.
| Compound Name | 2-[3,5-bis(cyanomethyl)-2,4,6-trimethoxyphenyl]acetonitrile |
|---|---|
| PubChem CID | 86065154 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[3,5-bis(cyanomethyl)-2,4,6-trimethoxyphenyl]acetonitrile |
| SMILES | COc1c(CC#N)c(OC)c(CC#N)c(OC)c1CC#N |
| InChI | InChI=1S/C15H15N3O3/c1-19-13-10(4-7-16)14(20-2)12(6-9-18)15(21-3)11(13)5-8-17/h4-6H2,1-3H3 |
| InChIKey | NTSZPJNTGCOLNT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |